4-Bromophenylacetonitrile
Catalog No: FT-0623226
CAS No: 16532-79-9
- Chemical Name: 4-Bromophenylacetonitrile
- Molecular Formula: C8H6BrN
- Molecular Weight: 196.04
- InChI Key: MFHFWRBXPQDZSA-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6BrN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-Bromobenzyl cyanide |
|---|---|
| Bolling_Point: | 286.2±15.0 °C at 760 mmHg |
| MF: | C8H6BrN |
| Symbol: | GHS06 |
| Melting_Point: | 47-49 °C(lit.) |
| CAS: | 16532-79-9 |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 196.044 |
| Flash_Point: | 126.9±20.4 °C |
| MF: | C8H6BrN |
|---|---|
| Water_Solubility: | slightly soluble |
| Bolling_Point: | 286.2±15.0 °C at 760 mmHg |
| Exact_Mass: | 194.968353 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)47-49°C ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)152°C ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Melting_Point: | 47-49 °C(lit.) |
| PSA: | 23.79000 |
| Flash_Point: | 126.9±20.4 °C |
| Refractive_Index: | 1.573 |
| Density: | 1.5±0.1 g/cm3 |
| Molecular_Structure: | ['1 . Molar refractive index 4340 ', '2 . Molar volume (m3/mol)1318 ', '3 . Parachor (902K)3426 ', '4 . Surface tension 456 ', '5 . Polarizability 1720 ', '6 熔点47-49°C。 ', '7 闪点152°C。'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 238 ', '7. Heavy Atom Count :10 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :139 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| FW: | 196.044 |
| LogP: | 2.22 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Risk_Statements(EU): | R20/21/22;R36/37/38 |
|---|---|
| Hazard_Codes: | Xn:Harmful; |
| RTECS: | AL8090000 |
| HS_Code: | 2926909090 |
| Packing_Group: | III |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P280-P301 + P310-P305 + P351 + P338 |
| Safety_Statements: | H301-H312 + H332-H315-H319-H335 |
| Symbol: | GHS06 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard_Class: | 6.1 |
| RIDADR: | 3276 |
Related Products
Poly(iminocarbonimidoyliminocarbonimidoylimino-1,6-hexanediyl) hydrochloride
(2R,3S,5R)-5-(2-Amino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol